Information
    Formula C10H11F3N2O2 Count 960
Discontinued
C10H11F3N2O2 |  2,2-dimethyl-1-[3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopropane-1-carboxylic acid

2,2-dimethyl-1-[3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopropane-1-carboxylic acid

Compound number
MolPort-046-374-404
SMILES
CC1(C)CC1(C(O)=O)c1c[nH]nc1C(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  (1R,3R)-2,2-dimethyl-3-[3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopropane-1-carboxylic acid

(1R,3R)-2,2-dimethyl-3-[3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopropane-1-carboxylic acid

Compound number
MolPort-046-374-426
SMILES
CC1(C)[C@@H]([C@H]1c1c[nH]nc1C(F)(F)F)C(O)=O |r|
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1-[3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopentane-1-carboxylic acid

1-[3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopentane-1-carboxylic acid

Compound number
MolPort-046-375-853
SMILES
OC(=O)C1(CCCC1)c1c[nH]nc1C(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1,1,1-trifluoro-3-(2-methyl-6-nitrophenyl)propan-2-amine

1,1,1-trifluoro-3-(2-methyl-6-nitrophenyl)propan-2-amine

Compound number
MolPort-046-376-655
SMILES
Cc1cccc(c1CC(N)C(F)(F)F)[N+]([O-])=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  3,3,3-trifluoro-2-(2-methyl-6-nitrophenyl)propan-1-amine

3,3,3-trifluoro-2-(2-methyl-6-nitrophenyl)propan-1-amine

Compound number
MolPort-046-376-675
SMILES
Cc1cccc(c1C(CN)C(F)(F)F)[N+]([O-])=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1,1-difluoro-3-(2-fluoro-5-nitrophenyl)-2-methylpropan-2-amine

1,1-difluoro-3-(2-fluoro-5-nitrophenyl)-2-methylpropan-2-amine

Compound number
MolPort-046-378-232
SMILES
CC(N)(Cc1cc(ccc1F)[N+]([O-])=O)C(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1,1,1-trifluoro-3-(3-methyl-2-nitrophenyl)propan-2-amine

1,1,1-trifluoro-3-(3-methyl-2-nitrophenyl)propan-2-amine

Compound number
MolPort-046-379-524
SMILES
Cc1cccc(CC(N)C(F)(F)F)c1[N+]([O-])=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  3,3,3-trifluoro-2-(3-methyl-2-nitrophenyl)propan-1-amine

3,3,3-trifluoro-2-(3-methyl-2-nitrophenyl)propan-1-amine

Compound number
MolPort-046-379-798
SMILES
Cc1cccc(C(CN)C(F)(F)F)c1[N+]([O-])=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopentane-1-carboxylic acid

1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopentane-1-carboxylic acid

Compound number
MolPort-046-380-200
SMILES
OC(=O)C1(CCCC1)c1cc(n[nH]1)C(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  2-[3-nitro-5-(trifluoromethyl)phenyl]propan-1-amine

2-[3-nitro-5-(trifluoromethyl)phenyl]propan-1-amine

Compound number
MolPort-046-380-374
SMILES
CC(CN)c1cc(cc(c1)C(F)(F)F)[N+]([O-])=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  2-{1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclobutyl}acetic acid

2-{1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclobutyl}acetic acid

Compound number
MolPort-046-380-528
SMILES
OC(=O)CC1(CCC1)c1cc(n[nH]1)C(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  2,2-dimethyl-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopropane-1-carboxylic acid

2,2-dimethyl-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopropane-1-carboxylic acid

Compound number
MolPort-046-380-989
SMILES
CC1(C)C(C1c1cc(n[nH]1)C(F)(F)F)C(O)=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  2,2-dimethyl-1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopropane-1-carboxylic acid

2,2-dimethyl-1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopropane-1-carboxylic acid

Compound number
MolPort-046-380-994
SMILES
CC1(C)CC1(C(O)=O)c1cc(n[nH]1)C(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  (1R,3R)-2,2-dimethyl-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopropane-1-carboxylic acid

(1R,3R)-2,2-dimethyl-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]cyclopropane-1-carboxylic acid

Compound number
MolPort-046-381-015
SMILES
CC1(C)[C@@H]([C@H]1c1cc(n[nH]1)C(F)(F)F)C(O)=O |r|
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1-{[1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl}cyclopropane-1-carboxylic acid

1-{[1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl}cyclopropane-1-carboxylic acid

Compound number
MolPort-046-381-571
SMILES
Cn1nc(cc1CC1(CC1)C(O)=O)C(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1-{[1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}cyclopropane-1-carboxylic acid

1-{[1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}cyclopropane-1-carboxylic acid

Compound number
MolPort-046-384-976
SMILES
Cn1cc(CC2(CC2)C(O)=O)c(n1)C(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  1-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclobutane-1-carboxylic acid

1-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclobutane-1-carboxylic acid

Compound number
MolPort-046-385-245
SMILES
Cn1cc(c(n1)C(F)(F)F)C1(CCC1)C(O)=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  2-{1-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopropyl}acetic acid

2-{1-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]cyclopropyl}acetic acid

Compound number
MolPort-046-385-553
SMILES
Cn1cc(c(n1)C(F)(F)F)C1(CC(O)=O)CC1
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  (2R)-1-[3-nitro-5-(trifluoromethyl)phenyl]propan-2-amine

(2R)-1-[3-nitro-5-(trifluoromethyl)phenyl]propan-2-amine

Compound number
MolPort-046-415-314
SMILES
C[C@@H](N)Cc1cc(cc(c1)C(F)(F)F)[N+]([O-])=O
Molecular formula
C10H11F3N2O2
Molecular weight
248.21
Discontinued
C10H11F3N2O2 |  3,3,3-trifluoro-N-(2-methoxy-5-methylpyridin-3-yl)propanamide

3,3,3-trifluoro-N-(2-methoxy-5-methylpyridin-3-yl)propanamide

Compound number
MolPort-046-447-968
SMILES
COc1ncc(C)cc1NC(=O)CC(F)(F)F
Molecular formula
C10H11F3N2O2
Molecular weight
248.21

We use cookies to improve your experience on our websites and for advertising. By clicking "Accept All", you consent to our use of cookies. Learn more.

Feedback