Information
    Formula C12H14FNO4S Count 673
Discontinued
C12H14FNO4S |  1-(3-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

1-(3-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-359-538
SMILES
Cc1c(F)cccc1S(=O)(=O)N1CCCC1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-359-565
SMILES
OC(=O)C1CCCN1S(=O)(=O)Cc1cccc(F)c1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-3-carboxylic acid

1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-3-carboxylic acid

Compound number
MolPort-041-360-027
SMILES
OC(=O)C1CCN(C1)S(=O)(=O)Cc1ccccc1F
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-360-280
SMILES
Cc1cc(F)cc(c1)S(=O)(=O)N1CCCC1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-360-424
SMILES
OC(=O)C1CCCN1S(=O)(=O)Cc1ccccc1F
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-(2-fluoro-4-methylbenzenesulfonyl)pyrrolidine-3-carboxylic acid

1-(2-fluoro-4-methylbenzenesulfonyl)pyrrolidine-3-carboxylic acid

Compound number
MolPort-041-360-838
SMILES
Cc1ccc(c(F)c1)S(=O)(=O)N1CCC(C1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-3-carboxylic acid

1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-3-carboxylic acid

Compound number
MolPort-041-360-847
SMILES
Cc1cc(F)cc(c1)S(=O)(=O)N1CCC(C1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-3-carboxylic acid

1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-3-carboxylic acid

Compound number
MolPort-041-361-024
SMILES
OC(=O)C1CCN(C1)S(=O)(=O)Cc1cccc(F)c1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-(2-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

1-(2-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-361-041
SMILES
Cc1ccc(c(F)c1)S(=O)(=O)N1CCCC1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2R)-1-(3-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2R)-1-(3-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-362-179
SMILES
Cc1c(F)cccc1S(=O)(=O)N1CCC[C@@H]1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(2-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(2-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-362-201
SMILES
Cc1ccc(c(F)c1)S(=O)(=O)N1CCC[C@H]1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(3-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(3-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-362-420
SMILES
Cc1c(F)cccc1S(=O)(=O)N1CCC[C@H]1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-362-767
SMILES
Cc1cc(F)cc(c1)S(=O)(=O)N1CCC[C@H]1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2R)-1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

(2R)-1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-363-215
SMILES
OC(=O)[C@H]1CCCN1S(=O)(=O)Cc1cccc(F)c1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(4-fluoro-3-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(4-fluoro-3-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-363-365
SMILES
Cc1cc(ccc1F)S(=O)(=O)N1CCC[C@H]1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

(2S)-1-[(3-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-363-437
SMILES
OC(=O)[C@@H]1CCCN1S(=O)(=O)Cc1cccc(F)c1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

(2S)-1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-363-565
SMILES
OC(=O)[C@@H]1CCCN1S(=O)(=O)Cc1ccccc1F
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2R)-1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2R)-1-(3-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-364-085
SMILES
Cc1cc(F)cc(c1)S(=O)(=O)N1CCC[C@@H]1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2R)-1-(4-fluoro-3-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2R)-1-(4-fluoro-3-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-364-590
SMILES
Cc1cc(ccc1F)S(=O)(=O)N1CCC[C@@H]1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2R)-1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

(2R)-1-[(2-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-041-364-755
SMILES
OC(=O)[C@H]1CCCN1S(=O)(=O)Cc1ccccc1F
Molecular formula
C12H14FNO4S
Molecular weight
287.31

We use cookies to improve your experience on our websites and for advertising. By clicking "Accept All", you consent to our use of cookies. Learn more.

Feedback