Information
    Formula C12H14FNO4S Count 673
Discontinued
C12H14FNO4S |  2-[N-(cyclopropylmethyl)2-fluorobenzenesulfonamido]acetic acid

2-[N-(cyclopropylmethyl)2-fluorobenzenesulfonamido]acetic acid

Compound number
MolPort-011-991-160
SMILES
OC(=O)CN(CC1CC1)S(=O)(=O)c1ccccc1F
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-[N-(cyclopropylmethyl)4-fluorobenzenesulfonamido]acetic acid

2-[N-(cyclopropylmethyl)4-fluorobenzenesulfonamido]acetic acid

Compound number
MolPort-011-991-161
SMILES
OC(=O)CN(CC1CC1)S(=O)(=O)c1ccc(F)cc1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  5-[(1,1-dioxo-1λ⁶-thian-4-yl)amino]-2-fluorobenzoic acid

5-[(1,1-dioxo-1λ⁶-thian-4-yl)amino]-2-fluorobenzoic acid

Compound number
MolPort-012-062-546
SMILES
OC(=O)c1cc(NC2CCS(=O)(=O)CC2)ccc1F
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  3-[(1,1-dioxo-1λ⁶-thian-4-yl)amino]-4-fluorobenzoic acid

3-[(1,1-dioxo-1λ⁶-thian-4-yl)amino]-4-fluorobenzoic acid

Compound number
MolPort-012-062-741
SMILES
OC(=O)c1ccc(F)c(NC2CCS(=O)(=O)CC2)c1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-[(1,1-dioxo-1λ⁶-thiolan-3-yl)(methyl)amino]-5-fluorobenzoic acid

2-[(1,1-dioxo-1λ⁶-thiolan-3-yl)(methyl)amino]-5-fluorobenzoic acid

Compound number
MolPort-012-178-816
SMILES
CN(C1CCS(=O)(=O)C1)c1ccc(F)cc1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(2-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(2-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-012-200-282
SMILES
Cc1ccc(F)c(c1)S(=O)(=O)N1CCC[C@H]1C(O)=O |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(3-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(3-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-012-200-284
SMILES
Cc1ccc(cc1F)S(=O)(=O)N1CCC[C@H]1C(O)=O |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-[(4-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

(2S)-1-[(4-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-012-200-291
SMILES
OC(=O)[C@@H]1CCCN1S(=O)(=O)Cc1ccc(F)cc1 |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(4-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(4-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-012-200-415
SMILES
Cc1cc(F)ccc1S(=O)(=O)N1CCC[C@H]1C(O)=O |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-1-(5-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

(2S)-1-(5-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-012-200-419
SMILES
Cc1ccc(F)cc1S(=O)(=O)N1CCC[C@H]1C(O)=O |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-2-{3-[(2-fluorophenyl)sulfanyl]propanamido}-3-hydroxypropanoic acid

(2S)-2-{3-[(2-fluorophenyl)sulfanyl]propanamido}-3-hydroxypropanoic acid

Compound number
MolPort-012-204-717
SMILES
OC[C@H](NC(=O)CCSc1ccccc1F)C(O)=O |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-2-(2-{[(4-fluorophenyl)methyl]sulfanyl}acetamido)-3-hydroxypropanoic acid

(2S)-2-(2-{[(4-fluorophenyl)methyl]sulfanyl}acetamido)-3-hydroxypropanoic acid

Compound number
MolPort-012-204-956
SMILES
OC[C@H](NC(=O)CSCc1ccc(F)cc1)C(O)=O |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  (2S)-2-{3-[(4-fluorophenyl)sulfanyl]propanamido}-3-hydroxypropanoic acid

(2S)-2-{3-[(4-fluorophenyl)sulfanyl]propanamido}-3-hydroxypropanoic acid

Compound number
MolPort-012-204-963
SMILES
OC[C@H](NC(=O)CCSc1ccc(F)cc1)C(O)=O |r|
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  N-[2-fluoro-4-(3-hydroxyprop-1-yn-1-yl)phenyl]-2-methoxyethane-1-sulfonamide

N-[2-fluoro-4-(3-hydroxyprop-1-yn-1-yl)phenyl]-2-methoxyethane-1-sulfonamide

Compound number
MolPort-012-417-678
SMILES
COCCS(=O)(=O)Nc1ccc(cc1F)C#CCO
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  N-[4-fluoro-2-(3-hydroxyprop-1-yn-1-yl)phenyl]-2-methoxyethane-1-sulfonamide

N-[4-fluoro-2-(3-hydroxyprop-1-yn-1-yl)phenyl]-2-methoxyethane-1-sulfonamide

Compound number
MolPort-012-417-683
SMILES
COCCS(=O)(=O)Nc1ccc(F)cc1C#CCO
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  5-[(2,2-dimethylcyclopropyl)sulfamoyl]-2-fluorobenzoic acid

5-[(2,2-dimethylcyclopropyl)sulfamoyl]-2-fluorobenzoic acid

Compound number
MolPort-012-526-707
SMILES
CC1(C)CC1NS(=O)(=O)c1ccc(F)c(c1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  3-[(2,2-dimethylcyclopropyl)sulfamoyl]-4-fluorobenzoic acid

3-[(2,2-dimethylcyclopropyl)sulfamoyl]-4-fluorobenzoic acid

Compound number
MolPort-012-526-708
SMILES
CC1(C)CC1NS(=O)(=O)c1cc(ccc1F)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  methyl 2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ⁶-benzothiopyran-4-yl)amino]acetate

methyl 2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ⁶-benzothiopyran-4-yl)amino]acetate

Compound number
MolPort-012-646-429
SMILES
COC(=O)CNC1CCS(=O)(=O)c2ccc(F)cc12
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  3-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ⁶-benzothiopyran-4-yl)amino]propanoic acid

3-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ⁶-benzothiopyran-4-yl)amino]propanoic acid

Compound number
MolPort-012-646-485
SMILES
OC(=O)CCNC1CCS(=O)(=O)c2ccc(F)cc12
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-fluoro-6-{2-[(2-methoxyethyl)sulfanyl]acetamido}benzoic acid

2-fluoro-6-{2-[(2-methoxyethyl)sulfanyl]acetamido}benzoic acid

Compound number
MolPort-012-649-094
SMILES
COCCSCC(=O)Nc1cccc(F)c1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31

We use cookies to improve your experience on our websites and for advertising. By clicking "Accept All", you consent to our use of cookies. Learn more.

Feedback