Information
    Formula C12H14FNO4S Count 673
Discontinued
C12H14FNO4S |  2-cyclopropyl-2-(2-fluorobenzenesulfonamido)propanoic acid

2-cyclopropyl-2-(2-fluorobenzenesulfonamido)propanoic acid

Compound number
MolPort-013-282-825
SMILES
CC(NS(=O)(=O)c1ccccc1F)(C1CC1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-cyclopropyl-2-(3-fluorobenzenesulfonamido)propanoic acid

2-cyclopropyl-2-(3-fluorobenzenesulfonamido)propanoic acid

Compound number
MolPort-013-282-829
SMILES
CC(NS(=O)(=O)c1cccc(F)c1)(C1CC1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-(5-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

1-(5-fluoro-2-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-013-289-365
SMILES
Cc1ccc(F)cc1S(=O)(=O)N1CCCC1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-(2-{[(4-fluorophenyl)methyl]sulfanyl}acetamido)-3-hydroxypropanoic acid

2-(2-{[(4-fluorophenyl)methyl]sulfanyl}acetamido)-3-hydroxypropanoic acid

Compound number
MolPort-013-308-775
SMILES
OCC(NC(=O)CSCc1ccc(F)cc1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-{3-[(2-fluorophenyl)sulfanyl]propanamido}-3-hydroxypropanoic acid

2-{3-[(2-fluorophenyl)sulfanyl]propanamido}-3-hydroxypropanoic acid

Compound number
MolPort-013-308-991
SMILES
OCC(NC(=O)CCSc1ccccc1F)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  4-fluoro-2-{2-[(2-methoxyethyl)sulfanyl]acetamido}benzoic acid

4-fluoro-2-{2-[(2-methoxyethyl)sulfanyl]acetamido}benzoic acid

Compound number
MolPort-013-310-050
SMILES
COCCSCC(=O)Nc1cc(F)ccc1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  5-fluoro-2-{2-[(2-methoxyethyl)sulfanyl]acetamido}benzoic acid

5-fluoro-2-{2-[(2-methoxyethyl)sulfanyl]acetamido}benzoic acid

Compound number
MolPort-013-311-530
SMILES
COCCSCC(=O)Nc1ccc(F)cc1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-[(4-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

1-[(4-fluorophenyl)methanesulfonyl]pyrrolidine-2-carboxylic acid

Compound number
MolPort-013-313-683
SMILES
OC(=O)C1CCCN1S(=O)(=O)Cc1ccc(F)cc1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-(3-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

1-(3-fluoro-4-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-013-313-688
SMILES
Cc1ccc(cc1F)S(=O)(=O)N1CCCC1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  1-(2-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

1-(2-fluoro-5-methylbenzenesulfonyl)pyrrolidine-2-carboxylic acid

Compound number
MolPort-013-313-689
SMILES
Cc1ccc(F)c(c1)S(=O)(=O)N1CCCC1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  3-[(cyclobutylmethyl)sulfamoyl]-4-fluorobenzoic acid

3-[(cyclobutylmethyl)sulfamoyl]-4-fluorobenzoic acid

Compound number
MolPort-013-317-219
SMILES
OC(=O)c1ccc(F)c(c1)S(=O)(=O)NCC1CCC1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  5-[(cyclobutylmethyl)sulfamoyl]-2-fluorobenzoic acid

5-[(cyclobutylmethyl)sulfamoyl]-2-fluorobenzoic acid

Compound number
MolPort-013-317-224
SMILES
OC(=O)c1cc(ccc1F)S(=O)(=O)NCC1CCC1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-[(1,1-dioxo-1λ⁶-thian-4-yl)amino]-3-fluorobenzoic acid

2-[(1,1-dioxo-1λ⁶-thian-4-yl)amino]-3-fluorobenzoic acid

Compound number
MolPort-013-359-056
SMILES
OC(=O)c1cccc(F)c1NC1CCS(=O)(=O)CC1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-[(1,1-dioxo-1λ⁶-thiolan-3-yl)(methyl)amino]-3-fluorobenzoic acid

2-[(1,1-dioxo-1λ⁶-thiolan-3-yl)(methyl)amino]-3-fluorobenzoic acid

Compound number
MolPort-013-359-062
SMILES
CN(C1CCS(=O)(=O)C1)c1c(F)cccc1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  3-fluoro-2-[(3-methyl-1,1-dioxo-1λ⁶-thiolan-3-yl)amino]benzoic acid

3-fluoro-2-[(3-methyl-1,1-dioxo-1λ⁶-thiolan-3-yl)amino]benzoic acid

Compound number
MolPort-013-359-885
SMILES
CC1(CCS(=O)(=O)C1)Nc1c(F)cccc1C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-{[(1,1-dioxo-1λ⁶-thiolan-3-yl)methyl]amino}-3-fluorobenzoic acid

2-{[(1,1-dioxo-1λ⁶-thiolan-3-yl)methyl]amino}-3-fluorobenzoic acid

Compound number
MolPort-013-360-088
SMILES
OC(=O)c1cccc(F)c1NCC1CCS(=O)(=O)C1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-cyclopropyl-2-(4-fluoro-2-methylbenzenesulfonamido)acetic acid

2-cyclopropyl-2-(4-fluoro-2-methylbenzenesulfonamido)acetic acid

Compound number
MolPort-013-413-427
SMILES
Cc1cc(F)ccc1S(=O)(=O)NC(C1CC1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-cyclopropyl-2-(5-fluoro-2-methylbenzenesulfonamido)acetic acid

2-cyclopropyl-2-(5-fluoro-2-methylbenzenesulfonamido)acetic acid

Compound number
MolPort-013-413-429
SMILES
Cc1ccc(F)cc1S(=O)(=O)NC(C1CC1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-cyclopropyl-2-[(4-fluorophenyl)methanesulfonamido]acetic acid

2-cyclopropyl-2-[(4-fluorophenyl)methanesulfonamido]acetic acid

Compound number
MolPort-013-413-434
SMILES
OC(=O)C(NS(=O)(=O)Cc1ccc(F)cc1)C1CC1
Molecular formula
C12H14FNO4S
Molecular weight
287.31
Discontinued
C12H14FNO4S |  2-cyclopropyl-2-(2-fluoro-5-methylbenzenesulfonamido)acetic acid

2-cyclopropyl-2-(2-fluoro-5-methylbenzenesulfonamido)acetic acid

Compound number
MolPort-013-413-514
SMILES
Cc1ccc(F)c(c1)S(=O)(=O)NC(C1CC1)C(O)=O
Molecular formula
C12H14FNO4S
Molecular weight
287.31

We use cookies to improve your experience on our websites and for advertising. By clicking "Accept All", you consent to our use of cookies. Learn more.

Feedback