Information
    Formula C13H12BClO3 Count 26
In stock
C13H12BClO3 |  [2-(benzyloxy)-5-chlorophenyl]boronic acid

[2-(benzyloxy)-5-chlorophenyl]boronic acid

Compound number
MolPort-000-931-589
SMILES
OB(O)c1cc(Cl)ccc1OCc1ccccc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  [4-(benzyloxy)-3-chlorophenyl]boronic acid

[4-(benzyloxy)-3-chlorophenyl]boronic acid

Compound number
MolPort-000-931-667
SMILES
OB(O)c1ccc(OCc2ccccc2)c(Cl)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  [4-(benzyloxy)-2-chlorophenyl]boronic acid

[4-(benzyloxy)-2-chlorophenyl]boronic acid

Compound number
MolPort-000-931-702
SMILES
OB(O)c1ccc(OCc2ccccc2)cc1Cl
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  [3-(benzyloxy)-4-chlorophenyl]boronic acid

[3-(benzyloxy)-4-chlorophenyl]boronic acid

Compound number
MolPort-000-931-771
SMILES
OB(O)c1ccc(Cl)c(OCc2ccccc2)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {2-[(2-chlorophenyl)methoxy]phenyl}boronic acid

{2-[(2-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-002-052-408
SMILES
OB(O)c1ccccc1OCc1ccccc1Cl
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {3-[(2-chlorophenyl)methoxy]phenyl}boronic acid

{3-[(2-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-003-937-976
SMILES
OB(O)c1cccc(OCc2ccccc2Cl)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {2-[(3-chlorophenyl)methoxy]phenyl}boronic acid

{2-[(3-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-003-938-187
SMILES
OB(O)c1ccccc1OCc1cccc(Cl)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {3-[(3-chlorophenyl)methoxy]phenyl}boronic acid

{3-[(3-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-003-938-188
SMILES
OB(O)c1cccc(OCc2cccc(Cl)c2)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {3-[(4-chlorophenyl)methoxy]phenyl}boronic acid

{3-[(4-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-003-938-279
SMILES
OB(O)c1cccc(OCc2ccc(Cl)cc2)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {4-[(4-chlorophenyl)methoxy]phenyl}boronic acid

{4-[(4-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-003-938-280
SMILES
OB(O)c1ccc(OCc2ccc(Cl)cc2)cc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {2-[(4-chlorophenyl)methoxy]phenyl}boronic acid

{2-[(4-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-011-531-207
SMILES
OB(O)c1ccccc1OCc1ccc(Cl)cc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {4-[(2-chlorophenyl)methoxy]phenyl}boronic acid

{4-[(2-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-011-531-245
SMILES
OB(O)c1ccc(OCc2ccccc2Cl)cc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {4-[(3-chlorophenyl)methoxy]phenyl}boronic acid

{4-[(3-chlorophenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-011-531-250
SMILES
OB(O)c1ccc(OCc2cccc(Cl)c2)cc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {3-[(2-chlorophenoxy)methyl]phenyl}boronic acid

{3-[(2-chlorophenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-677
SMILES
OB(O)c1cccc(COc2ccccc2Cl)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {2-[(2-chlorophenoxy)methyl]phenyl}boronic acid

{2-[(2-chlorophenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-682
SMILES
OB(O)c1ccccc1COc1ccccc1Cl
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {4-[(2-chlorophenoxy)methyl]phenyl}boronic acid

{4-[(2-chlorophenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-683
SMILES
OB(O)c1ccc(COc2ccccc2Cl)cc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {3-[(4-chlorophenoxy)methyl]phenyl}boronic acid

{3-[(4-chlorophenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-687
SMILES
OB(O)c1cccc(COc2ccc(Cl)cc2)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {2-[(4-chlorophenoxy)methyl]phenyl}boronic acid

{2-[(4-chlorophenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-692
SMILES
OB(O)c1ccccc1COc1ccc(Cl)cc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {4-[(4-chlorophenoxy)methyl]phenyl}boronic acid

{4-[(4-chlorophenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-693
SMILES
OB(O)c1ccc(COc2ccc(Cl)cc2)cc1
Molecular formula
C13H12BClO3
Molecular weight
262.5
In stock
C13H12BClO3 |  {3-[(3-chlorophenoxy)methyl]phenyl}boronic acid

{3-[(3-chlorophenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-765
SMILES
OB(O)c1cccc(COc2cccc(Cl)c2)c1
Molecular formula
C13H12BClO3
Molecular weight
262.5

We use cookies to improve your experience on our websites and for advertising. By clicking "Accept All", you consent to our use of cookies. Learn more.

Feedback