Information
    Formula C14H15BO4 Count 42
Discontinued
C14H15BO4 |  [2-(benzyloxy)-3-methoxyphenyl]boronic acid

[2-(benzyloxy)-3-methoxyphenyl]boronic acid

Compound number
MolPort-000-931-821
SMILES
COc1cccc(B(O)O)c1OCc1ccccc1
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  [4-(benzyloxy)-3-methoxyphenyl]boronic acid

[4-(benzyloxy)-3-methoxyphenyl]boronic acid

Compound number
MolPort-001-767-841
SMILES
COc1cc(ccc1OCc1ccccc1)B(O)O
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  {3-[(3-methoxyphenyl)methoxy]phenyl}boronic acid

{3-[(3-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-001-768-481
SMILES
COc1cccc(COc2cccc(c2)B(O)O)c1
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  {4-[(2-methoxyphenyl)methoxy]phenyl}boronic acid

{4-[(2-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-003-938-414
SMILES
COc1ccccc1COc1ccc(cc1)B(O)O
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  {2-[(2-methoxyphenyl)methoxy]phenyl}boronic acid

{2-[(2-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-003-938-415
SMILES
COc1ccccc1COc1ccccc1B(O)O
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  1-benzyl-3-(dihydroxyboranyl)cyclohexa-2,4-diene-1-carboxylic acid

1-benzyl-3-(dihydroxyboranyl)cyclohexa-2,4-diene-1-carboxylic acid

Compound number
MolPort-004-747-596
SMILES
OB(O)C1=CC(Cc2ccccc2)(CC=C1)C(O)=O |c:15,t:3|
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  [2-(benzyloxy)-5-methoxyphenyl]boronic acid

[2-(benzyloxy)-5-methoxyphenyl]boronic acid

Compound number
MolPort-006-704-962
SMILES
COc1ccc(OCc2ccccc2)c(c1)B(O)O
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  {2-[(4-methoxyphenyl)methoxy]phenyl}boronic acid

{2-[(4-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-006-715-281
SMILES
COc1ccc(COc2ccccc2B(O)O)cc1
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  {3-[(4-methoxyphenyl)methoxy]phenyl}boronic acid

{3-[(4-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-006-715-415
SMILES
COc1ccc(COc2cccc(c2)B(O)O)cc1
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  {3-[(2-methoxyphenyl)methoxy]phenyl}boronic acid

{3-[(2-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-006-715-431
SMILES
COc1ccccc1COc1cccc(c1)B(O)O
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  {4-[(4-methoxyphenyl)methoxy]phenyl}boronic acid

{4-[(4-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-006-715-434
SMILES
COc1ccc(COc2ccc(cc2)B(O)O)cc1
Molecular formula
C14H15BO4
Molecular weight
258.08
In stock
C14H15BO4 |  [3-(benzyloxy)-4-methoxyphenyl]boronic acid

[3-(benzyloxy)-4-methoxyphenyl]boronic acid

Compound number
MolPort-006-715-695
SMILES
COc1ccc(cc1OCc1ccccc1)B(O)O
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  [2-(oxolan-3-yloxy)naphthalen-1-yl]boronic acid

[2-(oxolan-3-yloxy)naphthalen-1-yl]boronic acid

Compound number
MolPort-011-318-651
SMILES
OB(O)c1c(OC2CCOC2)ccc2ccccc12
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  [6-(oxolan-3-yloxy)naphthalen-2-yl]boronic acid

[6-(oxolan-3-yloxy)naphthalen-2-yl]boronic acid

Compound number
MolPort-011-318-652
SMILES
OB(O)c1ccc2cc(OC3CCOC3)ccc2c1
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  {2-[(3-methoxyphenyl)methoxy]phenyl}boronic acid

{2-[(3-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-011-531-196
SMILES
COc1cccc(COc2ccccc2B(O)O)c1
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  {4-[(3-methoxyphenyl)methoxy]phenyl}boronic acid

{4-[(3-methoxyphenyl)methoxy]phenyl}boronic acid

Compound number
MolPort-011-531-240
SMILES
COc1cccc(COc2ccc(cc2)B(O)O)c1
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  {3-[(3-methoxyphenoxy)methyl]phenyl}boronic acid

{3-[(3-methoxyphenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-647
SMILES
COc1cccc(OCc2cccc(c2)B(O)O)c1
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  {2-[(3-methoxyphenoxy)methyl]phenyl}boronic acid

{2-[(3-methoxyphenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-652
SMILES
COc1cccc(OCc2ccccc2B(O)O)c1
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  {4-[(3-methoxyphenoxy)methyl]phenyl}boronic acid

{4-[(3-methoxyphenoxy)methyl]phenyl}boronic acid

Compound number
MolPort-013-078-653
SMILES
COc1cccc(OCc2ccc(cc2)B(O)O)c1
Molecular formula
C14H15BO4
Molecular weight
258.08
Discontinued
C14H15BO4 |  [4-methoxy-3-(phenoxymethyl)phenyl]boronic acid

[4-methoxy-3-(phenoxymethyl)phenyl]boronic acid

Compound number
MolPort-013-078-753
SMILES
COc1ccc(cc1COc1ccccc1)B(O)O
Molecular formula
C14H15BO4
Molecular weight
258.08

We use cookies to improve your experience on our websites and for advertising. By clicking "Accept All", you consent to our use of cookies. Learn more.

Feedback