Information
    Formula C36H43FN6O6 Count 978
Discontinued
C36H43FN6O6 |  3-(2-{4-[({[5-(dimethylcarbamoyl)-2-methoxyphenyl]carbamoyl}methyl)carbamoyl]piperidin-1-yl}propanamido)-N-[(4-fluorophenyl)methyl]-4-methylbenzamide

3-(2-{4-[({[5-(dimethylcarbamoyl)-2-methoxyphenyl]carbamoyl}methyl)carbamoyl]piperidin-1-yl}propanamido)-N-[(4-fluorophenyl)methyl]-4-methylbenzamide

Compound number
MolPort-017-273-238
SMILES
COc1ccc(cc1NC(=O)CNC(=O)C1CCN(CC1)C(C)C(=O)Nc1cc(ccc1C)C(=O)NCc1ccc(F)cc1)C(=O)N(C)C
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-(butan-2-yl)-3-[2-(4-{[({5-[(4-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

N-(butan-2-yl)-3-[2-(4-{[({5-[(4-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

Compound number
MolPort-017-276-813
SMILES
CCC(C)NC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NCC(=O)Nc2cc(ccc2OC)C(=O)Nc2ccc(F)cc2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-(butan-2-yl)-3-[2-(4-{[({5-[(3-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

N-(butan-2-yl)-3-[2-(4-{[({5-[(3-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

Compound number
MolPort-017-276-815
SMILES
CCC(C)NC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NCC(=O)Nc2cc(ccc2OC)C(=O)Nc2cccc(F)c2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-(butan-2-yl)-3-[2-(4-{[({5-[(2-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

N-(butan-2-yl)-3-[2-(4-{[({5-[(2-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

Compound number
MolPort-017-276-816
SMILES
CCC(C)NC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NCC(=O)Nc2cc(ccc2OC)C(=O)Nc2ccccc2F)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N,N-diethyl-3-[2-(4-{[({5-[(4-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

N,N-diethyl-3-[2-(4-{[({5-[(4-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

Compound number
MolPort-017-277-815
SMILES
CCN(CC)C(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NCC(=O)Nc2cc(ccc2OC)C(=O)Nc2ccc(F)cc2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N,N-diethyl-3-[2-(4-{[({5-[(3-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

N,N-diethyl-3-[2-(4-{[({5-[(3-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

Compound number
MolPort-017-277-817
SMILES
CCN(CC)C(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NCC(=O)Nc2cc(ccc2OC)C(=O)Nc2cccc(F)c2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N,N-diethyl-3-[2-(4-{[({5-[(2-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

N,N-diethyl-3-[2-(4-{[({5-[(2-fluorophenyl)carbamoyl]-2-methoxyphenyl}carbamoyl)methyl]carbamoyl}piperidin-1-yl)acetamido]-4-methylbenzamide

Compound number
MolPort-017-277-818
SMILES
CCN(CC)C(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NCC(=O)Nc2cc(ccc2OC)C(=O)Nc2ccccc2F)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N,N-diethyl-3-(2-{4-[({[4-fluoro-3-(2-methoxybenzamido)phenyl]carbamoyl}methyl)carbamoyl]piperidin-1-yl}acetamido)-4-methylbenzamide

N,N-diethyl-3-(2-{4-[({[4-fluoro-3-(2-methoxybenzamido)phenyl]carbamoyl}methyl)carbamoyl]piperidin-1-yl}acetamido)-4-methylbenzamide

Compound number
MolPort-017-277-827
SMILES
CCN(CC)C(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NCC(=O)Nc2ccc(F)c(NC(=O)c3ccccc3OC)c2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-[(4-fluorophenyl)methyl]-3-(2-{4-[(1-{[2-methoxy-5-(methylcarbamoyl)phenyl]carbamoyl}ethyl)carbamoyl]piperidin-1-yl}propanamido)-4-methylbenzamide

N-[(4-fluorophenyl)methyl]-3-(2-{4-[(1-{[2-methoxy-5-(methylcarbamoyl)phenyl]carbamoyl}ethyl)carbamoyl]piperidin-1-yl}propanamido)-4-methylbenzamide

Compound number
MolPort-017-278-453
SMILES
CNC(=O)c1ccc(OC)c(NC(=O)C(C)NC(=O)C2CCN(CC2)C(C)C(=O)Nc2cc(ccc2C)C(=O)NCc2ccc(F)cc2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-[(4-fluorophenyl)methyl]-3-{2-[4-({1-[(3-methoxy-4-propanamidophenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]acetamido}-4-methylbenzamide

N-[(4-fluorophenyl)methyl]-3-{2-[4-({1-[(3-methoxy-4-propanamidophenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]acetamido}-4-methylbenzamide

Compound number
MolPort-017-283-845
SMILES
CCC(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CCN(CC(=O)Nc3cc(ccc3C)C(=O)NCc3ccc(F)cc3)CC2)cc1OC
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-[(4-fluorophenyl)methyl]-3-{2-[4-({2-[(3-methoxy-4-propanamidophenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]acetamido}-4-methylbenzamide

N-[(4-fluorophenyl)methyl]-3-{2-[4-({2-[(3-methoxy-4-propanamidophenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]acetamido}-4-methylbenzamide

Compound number
MolPort-017-284-051
SMILES
CCC(=O)Nc1ccc(NC(=O)CCNC(=O)C2CCN(CC(=O)Nc3cc(ccc3C)C(=O)NCc3ccc(F)cc3)CC2)cc1OC
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  3-{2-[4-({2-[(4-acetamido-3-methoxyphenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]propanamido}-N-(5-fluoro-2-methylphenyl)-4-methylbenzamide

3-{2-[4-({2-[(4-acetamido-3-methoxyphenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]propanamido}-N-(5-fluoro-2-methylphenyl)-4-methylbenzamide

Compound number
MolPort-017-284-559
SMILES
COc1cc(NC(=O)CCNC(=O)C2CCN(CC2)C(C)C(=O)Nc2cc(ccc2C)C(=O)Nc2cc(F)ccc2C)ccc1NC(C)=O
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  3-{2-[4-({2-[(3-acetamido-4-methoxyphenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]propanamido}-N-(5-fluoro-2-methylphenyl)-4-methylbenzamide

3-{2-[4-({2-[(3-acetamido-4-methoxyphenyl)carbamoyl]ethyl}carbamoyl)piperidin-1-yl]propanamido}-N-(5-fluoro-2-methylphenyl)-4-methylbenzamide

Compound number
MolPort-017-284-731
SMILES
COc1ccc(NC(=O)CCNC(=O)C2CCN(CC2)C(C)C(=O)Nc2cc(ccc2C)C(=O)Nc2cc(F)ccc2C)cc1NC(C)=O
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-(4-fluoro-2-methylphenyl)-3-{2-[4-({[(3-methoxy-4-propanamidophenyl)carbamoyl]methyl}carbamoyl)piperidin-1-yl]propanamido}-4-methylbenzamide

N-(4-fluoro-2-methylphenyl)-3-{2-[4-({[(3-methoxy-4-propanamidophenyl)carbamoyl]methyl}carbamoyl)piperidin-1-yl]propanamido}-4-methylbenzamide

Compound number
MolPort-017-284-816
SMILES
CCC(=O)Nc1ccc(NC(=O)CNC(=O)C2CCN(CC2)C(C)C(=O)Nc2cc(ccc2C)C(=O)Nc2ccc(F)cc2C)cc1OC
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  N-(4-fluoro-2-methylphenyl)-3-{2-[4-({[(4-methoxy-3-propanamidophenyl)carbamoyl]methyl}carbamoyl)piperidin-1-yl]propanamido}-4-methylbenzamide

N-(4-fluoro-2-methylphenyl)-3-{2-[4-({[(4-methoxy-3-propanamidophenyl)carbamoyl]methyl}carbamoyl)piperidin-1-yl]propanamido}-4-methylbenzamide

Compound number
MolPort-017-284-998
SMILES
CCC(=O)Nc1cc(NC(=O)CNC(=O)C2CCN(CC2)C(C)C(=O)Nc2cc(ccc2C)C(=O)Nc2ccc(F)cc2C)ccc1OC
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  3-(2-{4-[(1-{[2-fluoro-5-(4-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

3-(2-{4-[(1-{[2-fluoro-5-(4-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

Compound number
MolPort-017-288-016
SMILES
CNC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NC(C(C)C)C(=O)Nc2cc(NC(=O)c3ccc(OC)cc3)ccc2F)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  3-(2-{4-[(1-{[2-fluoro-5-(3-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

3-(2-{4-[(1-{[2-fluoro-5-(3-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

Compound number
MolPort-017-288-031
SMILES
CNC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NC(C(C)C)C(=O)Nc2cc(NC(=O)c3cccc(OC)c3)ccc2F)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  3-(2-{4-[(1-{[2-fluoro-5-(2-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

3-(2-{4-[(1-{[2-fluoro-5-(2-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

Compound number
MolPort-017-288-032
SMILES
CNC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NC(C(C)C)C(=O)Nc2cc(NC(=O)c3ccccc3OC)ccc2F)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  3-(2-{4-[(1-{[4-fluoro-3-(4-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

3-(2-{4-[(1-{[4-fluoro-3-(4-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

Compound number
MolPort-017-288-039
SMILES
CNC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NC(C(C)C)C(=O)Nc2ccc(F)c(NC(=O)c3ccc(OC)cc3)c2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77
Discontinued
C36H43FN6O6 |  3-(2-{4-[(1-{[4-fluoro-3-(3-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

3-(2-{4-[(1-{[4-fluoro-3-(3-methoxybenzamido)phenyl]carbamoyl}-2-methylpropyl)carbamoyl]piperidin-1-yl}acetamido)-N,4-dimethylbenzamide

Compound number
MolPort-017-288-061
SMILES
CNC(=O)c1ccc(C)c(NC(=O)CN2CCC(CC2)C(=O)NC(C(C)C)C(=O)Nc2ccc(F)c(NC(=O)c3cccc(OC)c3)c2)c1
Molecular formula
C36H43FN6O6
Molecular weight
674.77

We use cookies to improve your experience on our websites and for advertising. By clicking "Accept All", you consent to our use of cookies. Learn more.

Feedback